C31H22ClN3O2 — CID 159162935
1-chloro-4-isocyanobenzene;1,3-dihydroinden-2-one;4-(2-oxo-3H-indol-1-yl)benzonitrile (PubChem CID 159162935) has the molecular formula C31H22ClN3O2 and a molecular weight of 503.99 g/mol. Its IUPAC name is 1-chloro-4-isocyanobenzene;1,3-dihydroinden-2-one;4-(2-oxo-3H-indol-1-yl)benzonitrile.
| Compound Name | 1-chloro-4-isocyanobenzene;1,3-dihydroinden-2-one;4-(2-oxo-3H-indol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 159162935 |
| Molecular Formula | C31H22ClN3O2 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 1-chloro-4-isocyanobenzene;1,3-dihydroinden-2-one;4-(2-oxo-3H-indol-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)Cc3ccccc32)cc1.O=C1Cc2ccccc2C1.[C-]#[N+]c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10N2O.C9H8O.C7H4ClN/c16-10-11-5-7-13(8-6-11)17-14-4-2-1-3-12(14)9-15(17)18;10-9-5-7-3-1-2-4-8(7)6-9;1-9-7-4-2-6(8)3-5-7/h1-8H,9H2;1-4H,5-6H2;2-5H |
| InChIKey | KKSLSCBRMCJAOZ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 65.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|