About 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine
2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine (PubChem CID 159170424) has the molecular formula C12H14I2N8O2
and a molecular weight of 556.11 g/mol. Its IUPAC name is 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine.
Molecular Properties
| Compound Name | 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine |
| PubChem CID | 159170424 |
| Molecular Formula | C12H14I2N8O2 |
| Molecular Weight | 556.11 g/mol |
| Exact Mass | 555.93 |
| IUPAC Name | 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine |
| SMILES | NCCOc1cnc(I)cn1.[N-]=[N+]=NCCOc1cnc(I)cn1 |
| InChI | InChI=1S/C6H6IN5O.C6H8IN3O/c7-5-3-10-6(4-9-5)13-2-1-11-12-8;7-5-3-10-6(4-9-5)11-2-1-8/h3-4H,1-2H2;3-4H,1-2,8H2 |
| InChIKey | KLPQRFBICKWVHI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 144.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 556.11 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine?
The IUPAC name of 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine (CID 159170424) is 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine.
What is the SMILES notation for 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine?
The canonical SMILES for 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine is NCCOc1cnc(I)cn1.[N-]=[N+]=NCCOc1cnc(I)cn1.
What is the InChIKey of 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine?
The InChIKey is KLPQRFBICKWVHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6IN5O.C6H8IN3O/c7-5-3-10-6(4-9-5)13-2-1-11-12-8;7-5-3-10-6(4-9-5)11-2-1-8/h3-4H,1-2H2;3-4H,1-2,8H2.
What are the key properties of 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine?
2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine has a molecular weight of 556.11 g/mol, XLogP of 2.19, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-azidoethoxy)-5-iodopyrazine;2-(5-iodopyrazin-2-yl)oxyethanamine is sourced from PubChem (CID 159170424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).