C16H32O6Sn — CID 159171014
dibutyltin;2,3-diethoxybutanedioic acid (PubChem CID 159171014) has the molecular formula C16H32O6Sn and a molecular weight of 439.14 g/mol. Its IUPAC name is dibutyltin;2,3-diethoxybutanedioic acid.
| Compound Name | dibutyltin;2,3-diethoxybutanedioic acid |
|---|---|
| PubChem CID | 159171014 |
| Molecular Formula | C16H32O6Sn |
| Molecular Weight | 439.14 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | dibutyltin;2,3-diethoxybutanedioic acid |
| SMILES | CCCC[Sn]CCCC.CCOC(C(=O)O)C(OCC)C(=O)O |
| InChI | InChI=1S/C8H14O6.2C4H9.Sn/c1-3-13-5(7(9)10)6(8(11)12)14-4-2;2*1-3-4-2;/h5-6H,3-4H2,1-2H3,(H,9,10)(H,11,12);2*1,3-4H2,2H3; |
| InChIKey | KLROHTYJXGJAOO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.14 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|