C19H17Cl2FN4O4 — CID 159174504
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[2-(5-chloro-2-fluoro-3-pyridinyl)ethyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 159174504) has the molecular formula C19H17Cl2FN4O4 and a molecular weight of 455.27 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[2-(5-chloro-2-fluoro-3-pyridinyl)ethyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[2-(5-chloro-2-fluoro-3-pyridinyl)ethyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 159174504 |
| Molecular Formula | C19H17Cl2FN4O4 |
| Molecular Weight | 455.27 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[2-(5-chloro-2-fluoro-3-pyridinyl)ethyl]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1nc2nc(CCc3cc(Cl)cnc3F)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C19H17Cl2FN4O4/c20-9-3-8(17(22)23-5-9)1-2-11-10(21)4-12-18(24-11)26-19(25-12)30-14-7-29-15-13(27)6-28-16(14)15/h3-5,13-16,27H,1-2,6-7H2,(H,24,25,26)/t13-,14-,15-,16-/m1/s1 |
| InChIKey | KMCKNUVXXZQUKZ-KLHDSHLOSA-N |
| XLogP | 2.49 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|