About potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate
potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate (PubChem CID 159180729) has the molecular formula C13H18KNO7
and a molecular weight of 339.39 g/mol. Its IUPAC name is potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate.
Molecular Properties
| Compound Name | potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate |
| PubChem CID | 159180729 |
| Molecular Formula | C13H18KNO7 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate |
| SMILES | CCOC(=O)C(=O)OCC.CCOC(=O)C([O-])=C(C)C#N.[K+] |
| InChI | InChI=1S/C7H9NO3.C6H10O4.K/c1-3-11-7(10)6(9)5(2)4-8;1-3-9-5(7)6(8)10-4-2;/h9H,3H2,1-2H3;3-4H2,1-2H3;/q;;+1/p-1 |
| InChIKey | KMVVENFVANSZGN-UHFFFAOYSA-M |
| XLogP | -3.18 |
| TPSA | 125.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate?
The IUPAC name of potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate (CID 159180729) is potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate.
What is the SMILES notation for potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate?
The canonical SMILES for potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate is CCOC(=O)C(=O)OCC.CCOC(=O)C([O-])=C(C)C#N.[K+].
What is the InChIKey of potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate?
The InChIKey is KMVVENFVANSZGN-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H9NO3.C6H10O4.K/c1-3-11-7(10)6(9)5(2)4-8;1-3-9-5(7)6(8)10-4-2;/h9H,3H2,1-2H3;3-4H2,1-2H3;/q;;+1/p-1.
What are the key properties of potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate?
potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate has a molecular weight of 339.39 g/mol, XLogP of -3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate;diethyl oxalate is sourced from PubChem (CID 159180729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).