C26H40F6N2O2 — CID 159183487
1-butyl-2-methylimidazole;(9Z,12Z)-2,2,3,3,4,4-hexafluorooctadeca-9,12-dienoic acid (PubChem CID 159183487) has the molecular formula C26H40F6N2O2 and a molecular weight of 526.61 g/mol. Its IUPAC name is 1-butyl-2-methylimidazole;(9Z,12Z)-2,2,3,3,4,4-hexafluorooctadeca-9,12-dienoic acid.
| Compound Name | 1-butyl-2-methylimidazole;(9Z,12Z)-2,2,3,3,4,4-hexafluorooctadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 159183487 |
| Molecular Formula | C26H40F6N2O2 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | 1-butyl-2-methylimidazole;(9Z,12Z)-2,2,3,3,4,4-hexafluorooctadeca-9,12-dienoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCC(F)(F)C(F)(F)C(F)(F)C(=O)O.CCCCn1ccnc1C |
| InChI | InChI=1S/C18H26F6O2.C8H14N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(19,20)18(23,24)17(21,22)15(25)26;1-3-4-6-10-7-5-9-8(10)2/h6-7,9-10H,2-5,8,11-14H2,1H3,(H,25,26);5,7H,3-4,6H2,1-2H3/b7-6-,10-9-; |
| InChIKey | KNESPQMMPHTWBS-NBTZWHCOSA-N |
| XLogP | 8.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|