About diiodovanadium;2,2-dimethyloxirane
diiodovanadium;2,2-dimethyloxirane (PubChem CID 159184352) has the molecular formula C4H8I2OV
and a molecular weight of 376.86 g/mol. Its IUPAC name is diiodovanadium;2,2-dimethyloxirane.
Molecular Properties
| Compound Name | diiodovanadium;2,2-dimethyloxirane |
| PubChem CID | 159184352 |
| Molecular Formula | C4H8I2OV |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.81 |
| IUPAC Name | diiodovanadium;2,2-dimethyloxirane |
| SMILES | CC1(C)CO1.I[V]I |
| InChI | InChI=1S/C4H8O.2HI.V/c1-4(2)3-5-4;;;/h3H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | KNHHWLNQCGKZQR-UHFFFAOYSA-L |
| XLogP | 2.56 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze diiodovanadium;2,2-dimethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiodovanadium;2,2-dimethyloxirane?
The IUPAC name of diiodovanadium;2,2-dimethyloxirane (CID 159184352) is diiodovanadium;2,2-dimethyloxirane.
What is the SMILES notation for diiodovanadium;2,2-dimethyloxirane?
The canonical SMILES for diiodovanadium;2,2-dimethyloxirane is CC1(C)CO1.I[V]I.
What is the InChIKey of diiodovanadium;2,2-dimethyloxirane?
The InChIKey is KNHHWLNQCGKZQR-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H8O.2HI.V/c1-4(2)3-5-4;;;/h3H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of diiodovanadium;2,2-dimethyloxirane?
diiodovanadium;2,2-dimethyloxirane has a molecular weight of 376.86 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diiodovanadium;2,2-dimethyloxirane is sourced from PubChem (CID 159184352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).