C73H52N8Si2 — CID 159185278
4,6-bis(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-N,N-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-amine (PubChem CID 159185278) has the molecular formula C73H52N8Si2 and a molecular weight of 1097.45 g/mol. Its IUPAC name is 4,6-bis(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-N,N-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-N,N-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 159185278 |
| Molecular Formula | C73H52N8Si2 |
| Molecular Weight | 1097.45 g/mol |
| Exact Mass | 1096.39 |
| IUPAC Name | 4,6-bis(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-N,N-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-amine |
| SMILES | c1ccc([Si]2(c3ccccc3)c3ccccc3N(c3nc(N(c4ccc(-c5ccncc5)cc4)c4ccc(-c5ccncc5)cc4)nc(N4c5ccccc5[Si](c5ccccc5)(c5ccccc5)c5ccccc54)n3)c3ccccc32)cc1 |
| InChI | InChI=1S/C73H52N8Si2/c1-5-21-59(22-6-1)82(60-23-7-2-8-24-60)67-33-17-13-29-63(67)80(64-30-14-18-34-68(64)82)72-76-71(79(57-41-37-53(38-42-57)55-45-49-74-50-46-55)58-43-39-54(40-44-58)56-47-51-75-52-48-56)77-73(78-72)81-65-31-15-19-35-69(65)83(61-25-9-3-10-26-61,62-27-11-4-12-28-62)70-36-20-16-32-66(70)81/h1-52H |
| InChIKey | LFWUNZXQQFZKSF-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 74.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1097.45 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|