C17H15N2Y- — CID 159185329
3-ethenyl-7-methyl-1-(2-methylphenyl)-2H-pyrrolo[2,3-b]pyridin-1-ium-2-ide;yttrium (PubChem CID 159185329) has the molecular formula C17H15N2Y- and a molecular weight of 336.23 g/mol. Its IUPAC name is 3-ethenyl-7-methyl-1-(2-methylphenyl)-2H-pyrrolo[2,3-b]pyridin-1-ium-2-ide;yttrium.
| Compound Name | 3-ethenyl-7-methyl-1-(2-methylphenyl)-2H-pyrrolo[2,3-b]pyridin-1-ium-2-ide;yttrium |
|---|---|
| PubChem CID | 159185329 |
| Molecular Formula | C17H15N2Y- |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 3-ethenyl-7-methyl-1-(2-methylphenyl)-2H-pyrrolo[2,3-b]pyridin-1-ium-2-ide;yttrium |
| SMILES | [H]/[C-]=C/c1[c-][n+](-c2ccccc2C)c2n(C)cccc1-2.[Y] |
| InChI | InChI=1S/C17H15N2.Y/c1-4-14-12-19(16-10-6-5-8-13(16)2)17-15(14)9-7-11-18(17)3;/h1,4-11H,2-3H3;/q-1; |
| InChIKey | GQZUYJXEKZDMQF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|