C16H20N2O3 — CID 159187654
(4,5-dimethyl-2-nitrophenyl)-[(2R)-2-ethyl-4-methyl-2,3-dihydropyrrol-1-yl]methanone (PubChem CID 159187654) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (4,5-dimethyl-2-nitrophenyl)-[(2R)-2-ethyl-4-methyl-2,3-dihydropyrrol-1-yl]methanone.
| Compound Name | (4,5-dimethyl-2-nitrophenyl)-[(2R)-2-ethyl-4-methyl-2,3-dihydropyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 159187654 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (4,5-dimethyl-2-nitrophenyl)-[(2R)-2-ethyl-4-methyl-2,3-dihydropyrrol-1-yl]methanone |
| SMILES | CC[C@@H]1CC(C)=CN1C(=O)c1cc(C)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N2O3/c1-5-13-6-10(2)9-17(13)16(19)14-7-11(3)12(4)8-15(14)18(20)21/h7-9,13H,5-6H2,1-4H3/t13-/m1/s1 |
| InChIKey | VRCYBKNNTLEPDB-CYBMUJFWSA-N |
| XLogP | 3.74 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|