C23H27NO4S — CID 159191042
(4-methylphenyl)-[1-[4-(2-methylsulfonylethyl)benzoyl]piperidin-4-yl]methanone (PubChem CID 159191042) has the molecular formula C23H27NO4S and a molecular weight of 413.54 g/mol. Its IUPAC name is (4-methylphenyl)-[1-[4-(2-methylsulfonylethyl)benzoyl]piperidin-4-yl]methanone.
| Compound Name | (4-methylphenyl)-[1-[4-(2-methylsulfonylethyl)benzoyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 159191042 |
| Molecular Formula | C23H27NO4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (4-methylphenyl)-[1-[4-(2-methylsulfonylethyl)benzoyl]piperidin-4-yl]methanone |
| SMILES | Cc1ccc(C(=O)C2CCN(C(=O)c3ccc(CCS(C)(=O)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H27NO4S/c1-17-3-7-19(8-4-17)22(25)20-11-14-24(15-12-20)23(26)21-9-5-18(6-10-21)13-16-29(2,27)28/h3-10,20H,11-16H2,1-2H3 |
| InChIKey | KOBYSXPBUVTCNT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |