C20H28F3NS2 — CID 159193916
N-ethyl-N-[(1S)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethyl]-1-phenylethanamine;sulfane (PubChem CID 159193916) has the molecular formula C20H28F3NS2 and a molecular weight of 403.58 g/mol. Its IUPAC name is N-ethyl-N-[(1S)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethyl]-1-phenylethanamine;sulfane.
| Compound Name | N-ethyl-N-[(1S)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethyl]-1-phenylethanamine;sulfane |
|---|---|
| PubChem CID | 159193916 |
| Molecular Formula | C20H28F3NS2 |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-ethyl-N-[(1S)-1-[3-methyl-5-(trifluoromethyl)phenyl]ethyl]-1-phenylethanamine;sulfane |
| SMILES | CCN(C(C)c1ccccc1)[C@@H](C)c1cc(C)cc(C(F)(F)F)c1.S.S |
| InChI | InChI=1S/C20H24F3N.2H2S/c1-5-24(15(3)17-9-7-6-8-10-17)16(4)18-11-14(2)12-19(13-18)20(21,22)23;;/h6-13,15-16H,5H2,1-4H3;2*1H2/t15?,16-;;/m0../s1 |
| InChIKey | KOKQVDCQVZMBDG-AWESVXIMSA-N |
| XLogP | 6.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |