C14H17N3O3S2 — CID 159195962
N-hydroxy-7-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-7-oxoheptanamide (PubChem CID 159195962) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-hydroxy-7-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-7-oxoheptanamide.
| Compound Name | N-hydroxy-7-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-7-oxoheptanamide |
|---|---|
| PubChem CID | 159195962 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-hydroxy-7-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-7-oxoheptanamide |
| SMILES | Cc1nc(-c2nc(C(=O)CCCCCC(=O)NO)cs2)cs1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-9-15-11(8-21-9)14-16-10(7-22-14)12(18)5-3-2-4-6-13(19)17-20/h7-8,20H,2-6H2,1H3,(H,17,19) |
| InChIKey | LKGDQZIYHUBJGT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|