C14H19N3OS2 — CID 167531734
1-[2-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexan-1-one (PubChem CID 167531734) has the molecular formula C14H19N3OS2 and a molecular weight of 309.46 g/mol. Its IUPAC name is 1-[2-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexan-1-one.
| Compound Name | 1-[2-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexan-1-one |
|---|---|
| PubChem CID | 167531734 |
| Molecular Formula | C14H19N3OS2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-[2-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-4-yl]hexan-1-one |
| SMILES | CCCCCC(=O)c1csc(-c2csc(CCN)n2)n1 |
| InChI | InChI=1S/C14H19N3OS2/c1-2-3-4-5-12(18)10-8-20-14(17-10)11-9-19-13(16-11)6-7-15/h8-9H,2-7,15H2,1H3 |
| InChIKey | YJZHPULKBMRRCF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|