C15H18N2O2S2 — CID 159538293
1-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]octane-1,7-dione (PubChem CID 159538293) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 1-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]octane-1,7-dione.
| Compound Name | 1-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]octane-1,7-dione |
|---|---|
| PubChem CID | 159538293 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 1-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]octane-1,7-dione |
| SMILES | CC(=O)CCCCCC(=O)c1csc(-c2csc(C)n2)n1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-10(18)6-4-3-5-7-14(19)12-8-21-15(17-12)13-9-20-11(2)16-13/h8-9H,3-7H2,1-2H3 |
| InChIKey | XWVBQBODVGASGN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|