C23H28N4O2S2 — CID 159195963
N-(2-aminophenyl)-7-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-7-oxoheptanamide (PubChem CID 159195963) has the molecular formula C23H28N4O2S2 and a molecular weight of 456.64 g/mol. Its IUPAC name is N-(2-aminophenyl)-7-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-7-oxoheptanamide.
| Compound Name | N-(2-aminophenyl)-7-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-7-oxoheptanamide |
|---|---|
| PubChem CID | 159195963 |
| Molecular Formula | C23H28N4O2S2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-(2-aminophenyl)-7-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-7-oxoheptanamide |
| SMILES | CC(C)Cc1sc(-c2nccs2)nc1C(=O)CCCCCC(=O)Nc1ccccc1N |
| InChI | InChI=1S/C23H28N4O2S2/c1-15(2)14-19-21(27-23(31-19)22-25-12-13-30-22)18(28)10-4-3-5-11-20(29)26-17-9-7-6-8-16(17)24/h6-9,12-13,15H,3-5,10-11,14,24H2,1-2H3,(H,26,29) |
| InChIKey | YNPGNJSKCWOMQB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|