C17H19N2O9P — CID 15920032
6,7-dihydroxy-1-[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (PubChem CID 15920032) has the molecular formula C17H19N2O9P and a molecular weight of 426.32 g/mol. Its IUPAC name is 6,7-dihydroxy-1-[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid.
| Compound Name | 6,7-dihydroxy-1-[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 15920032 |
| Molecular Formula | C17H19N2O9P |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 6,7-dihydroxy-1-[3-hydroxy-2-methyl-5-(phosphonooxymethyl)-4-pyridinyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid |
| SMILES | Cc1ncc(COP(=O)(O)O)c(C2NC(C(=O)O)Cc3cc(O)c(O)cc32)c1O |
| InChI | InChI=1S/C17H19N2O9P/c1-7-16(22)14(9(5-18-7)6-28-29(25,26)27)15-10-4-13(21)12(20)3-8(10)2-11(19-15)17(23)24/h3-5,11,15,19-22H,2,6H2,1H3,(H,23,24)(H2,25,26,27) |
| InChIKey | SDDDPLSPVHSPMC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 189.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|