C39H46 — CID 159200937
3,6-dibutyl-9,9-bis(3,5-dimethylphenyl)-2,7-dimethylfluorene (PubChem CID 159200937) has the molecular formula C39H46 and a molecular weight of 514.80 g/mol. Its IUPAC name is 3,6-dibutyl-9,9-bis(3,5-dimethylphenyl)-2,7-dimethylfluorene.
| Compound Name | 3,6-dibutyl-9,9-bis(3,5-dimethylphenyl)-2,7-dimethylfluorene |
|---|---|
| PubChem CID | 159200937 |
| Molecular Formula | C39H46 |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | 3,6-dibutyl-9,9-bis(3,5-dimethylphenyl)-2,7-dimethylfluorene |
| SMILES | CCCCc1cc2c(cc1C)C(c1cc(C)cc(C)c1)(c1cc(C)cc(C)c1)c1cc(C)c(CCCC)cc1-2 |
| InChI | InChI=1S/C39H46/c1-9-11-13-31-23-35-36-24-32(14-12-10-2)30(8)22-38(36)39(37(35)21-29(31)7,33-17-25(3)15-26(4)18-33)34-19-27(5)16-28(6)20-34/h15-24H,9-14H2,1-8H3 |
| InChIKey | WBTPEOHAYWQSOH-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |