C20H14N5+ — CID 159203488
19-phenyl-6,12,17,19-tetraza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1,3(8),4,6,10,13(18),14,16-octaene (PubChem CID 159203488) has the molecular formula C20H14N5+ and a molecular weight of 324.37 g/mol. Its IUPAC name is 19-phenyl-6,12,17,19-tetraza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1,3(8),4,6,10,13(18),14,16-octaene.
| Compound Name | 19-phenyl-6,12,17,19-tetraza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1,3(8),4,6,10,13(18),14,16-octaene |
|---|---|
| PubChem CID | 159203488 |
| Molecular Formula | C20H14N5+ |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 19-phenyl-6,12,17,19-tetraza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1,3(8),4,6,10,13(18),14,16-octaene |
| SMILES | c1ccc(-n2c3ncccc3n3c[n+]4c(c23)-c2ccncc2C4)cc1 |
| InChI | InChI=1S/C20H14N5/c1-2-5-15(6-3-1)25-19-17(7-4-9-22-19)24-13-23-12-14-11-21-10-8-16(14)18(23)20(24)25/h1-11,13H,12H2/q+1 |
| InChIKey | ITFNMKUEWNRQGN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|