C16H13N4+ — CID 159910653
19-methyl-6,12,19-triaza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1,3(8),4,6,10,13,15,17-octaene (PubChem CID 159910653) has the molecular formula C16H13N4+ and a molecular weight of 261.31 g/mol. Its IUPAC name is 19-methyl-6,12,19-triaza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1,3(8),4,6,10,13,15,17-octaene.
| Compound Name | 19-methyl-6,12,19-triaza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1,3(8),4,6,10,13,15,17-octaene |
|---|---|
| PubChem CID | 159910653 |
| Molecular Formula | C16H13N4+ |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 19-methyl-6,12,19-triaza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-1,3(8),4,6,10,13,15,17-octaene |
| SMILES | Cn1c2ccccc2n2c[n+]3c(c12)-c1ccncc1C3 |
| InChI | InChI=1S/C16H13N4/c1-18-13-4-2-3-5-14(13)20-10-19-9-11-8-17-7-6-12(11)15(19)16(18)20/h2-8,10H,9H2,1H3/q+1 |
| InChIKey | LIYSNKWHBAHLCM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|