C14H10N5+ — CID 162242182
1,6,13,17-tetraza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,14,16,18-octaene (PubChem CID 162242182) has the molecular formula C14H10N5+ and a molecular weight of 248.27 g/mol. Its IUPAC name is 1,6,13,17-tetraza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,14,16,18-octaene.
| Compound Name | 1,6,13,17-tetraza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,14,16,18-octaene |
|---|---|
| PubChem CID | 162242182 |
| Molecular Formula | C14H10N5+ |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1,6,13,17-tetraza-10-azoniapentacyclo[10.7.0.02,10.03,8.013,18]nonadeca-2(10),3(8),4,6,11,14,16,18-octaene |
| SMILES | c1cnc2cn3c4[n+](cc3n2c1)Cc1cnccc1-4 |
| InChI | InChI=1S/C14H10N5/c1-3-16-12-8-19-13(18(12)5-1)9-17-7-10-6-15-4-2-11(10)14(17)19/h1-6,8-9H,7H2/q+1 |
| InChIKey | XFCVMNGVRWURPX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 38.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|