C30H44F2N2O6 — CID 159210990
tert-butyl (3S)-4-[(1R,2S,5S)-2-[(3R)-5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-(4,4-difluorocyclohexyl)-4-oxobutanoate (PubChem CID 159210990) has the molecular formula C30H44F2N2O6 and a molecular weight of 566.69 g/mol. Its IUPAC name is tert-butyl (3S)-4-[(1R,2S,5S)-2-[(3R)-5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-(4,4-difluorocyclohexyl)-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-4-[(1R,2S,5S)-2-[(3R)-5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-(4,4-difluorocyclohexyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 159210990 |
| Molecular Formula | C30H44F2N2O6 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | tert-butyl (3S)-4-[(1R,2S,5S)-2-[(3R)-5-amino-3-(cyclopropylmethyl)-4,5-dioxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3-(4,4-difluorocyclohexyl)-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)C[C@@H](CC1CC1)C(=O)C(N)=O)C2(C)C)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C30H44F2N2O6/c1-28(2,3)40-22(36)14-19(17-8-10-30(31,32)11-9-17)27(39)34-15-20-23(29(20,4)5)24(34)21(35)13-18(12-16-6-7-16)25(37)26(33)38/h16-20,23-24H,6-15H2,1-5H3,(H2,33,38)/t18-,19+,20+,23+,24-/m1/s1 |
| InChIKey | BKRWYXUXAFCFKH-SVLHQOMZSA-N |
| XLogP | 4.07 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|