C17H15N2O+ — CID 15921293
10-methoxy-3-methyl-7H-pyrido[3,4-c]carbazol-3-ium (PubChem CID 15921293) has the molecular formula C17H15N2O+ and a molecular weight of 263.32 g/mol. Its IUPAC name is 10-methoxy-3-methyl-7H-pyrido[3,4-c]carbazol-3-ium.
| Compound Name | 10-methoxy-3-methyl-7H-pyrido[3,4-c]carbazol-3-ium |
|---|---|
| PubChem CID | 15921293 |
| Molecular Formula | C17H15N2O+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 10-methoxy-3-methyl-7H-pyrido[3,4-c]carbazol-3-ium |
| SMILES | COc1ccc2[nH]c3ccc4c[n+](C)ccc4c3c2c1 |
| InChI | InChI=1S/C17H14N2O/c1-19-8-7-13-11(10-19)3-5-16-17(13)14-9-12(20-2)4-6-15(14)18-16/h3-10H,1-2H3/p+1 |
| InChIKey | IPKMQSPWZBVTRS-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 28.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|