C38H43ClN2O10 — CID 159215074
methyl 2-chloro-2-oxoacetate;methyl 2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetate;4-(2-naphthalen-1-yloxyethyl)morpholine (PubChem CID 159215074) has the molecular formula C38H43ClN2O10 and a molecular weight of 723.22 g/mol. Its IUPAC name is methyl 2-chloro-2-oxoacetate;methyl 2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetate;4-(2-naphthalen-1-yloxyethyl)morpholine.
| Compound Name | methyl 2-chloro-2-oxoacetate;methyl 2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetate;4-(2-naphthalen-1-yloxyethyl)morpholine |
|---|---|
| PubChem CID | 159215074 |
| Molecular Formula | C38H43ClN2O10 |
| Molecular Weight | 723.22 g/mol |
| Exact Mass | 722.26 |
| IUPAC Name | methyl 2-chloro-2-oxoacetate;methyl 2-[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]-2-oxoacetate;4-(2-naphthalen-1-yloxyethyl)morpholine |
| SMILES | COC(=O)C(=O)Cl.COC(=O)C(=O)c1ccc(OCCN2CCOCC2)c2ccccc12.c1ccc2c(OCCN3CCOCC3)cccc2c1 |
| InChI | InChI=1S/C19H21NO5.C16H19NO2.C3H3ClO3/c1-23-19(22)18(21)16-6-7-17(15-5-3-2-4-14(15)16)25-13-10-20-8-11-24-12-9-20;1-2-6-15-14(4-1)5-3-7-16(15)19-13-10-17-8-11-18-12-9-17;1-7-3(6)2(4)5/h2-7H,8-13H2,1H3;1-7H,8-13H2;1H3 |
| InChIKey | KQYRGLNGYDJRIR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.22 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|