C30H28N4O2 — CID 159219786
1-benzyl-5-methoxyindazole;2-benzyl-5-methoxyindazole (PubChem CID 159219786) has the molecular formula C30H28N4O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 1-benzyl-5-methoxyindazole;2-benzyl-5-methoxyindazole.
| Compound Name | 1-benzyl-5-methoxyindazole;2-benzyl-5-methoxyindazole |
|---|---|
| PubChem CID | 159219786 |
| Molecular Formula | C30H28N4O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 1-benzyl-5-methoxyindazole;2-benzyl-5-methoxyindazole |
| SMILES | COc1ccc2c(cnn2Cc2ccccc2)c1.COc1ccc2nn(Cc3ccccc3)cc2c1 |
| InChI | InChI=1S/2C15H14N2O/c1-18-14-7-8-15-13(9-14)10-16-17(15)11-12-5-3-2-4-6-12;1-18-14-7-8-15-13(9-14)11-17(16-15)10-12-5-3-2-4-6-12/h2-10H,11H2,1H3;2-9,11H,10H2,1H3 |
| InChIKey | KRNPARSCNHXNTI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |