C35H36N4O4 — CID 159233110
(6S)-6-[(4-hydroxyphenyl)methyl]-2-methyl-8-(naphthalen-1-ylmethyl)-1-[(3S)-3-phenylbutanoyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione (PubChem CID 159233110) has the molecular formula C35H36N4O4 and a molecular weight of 576.70 g/mol. Its IUPAC name is (6S)-6-[(4-hydroxyphenyl)methyl]-2-methyl-8-(naphthalen-1-ylmethyl)-1-[(3S)-3-phenylbutanoyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione.
| Compound Name | (6S)-6-[(4-hydroxyphenyl)methyl]-2-methyl-8-(naphthalen-1-ylmethyl)-1-[(3S)-3-phenylbutanoyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
|---|---|
| PubChem CID | 159233110 |
| Molecular Formula | C35H36N4O4 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | (6S)-6-[(4-hydroxyphenyl)methyl]-2-methyl-8-(naphthalen-1-ylmethyl)-1-[(3S)-3-phenylbutanoyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
| SMILES | C[C@@H](CC(=O)N1C2CN(Cc3cccc4ccccc34)C(=O)[C@H](Cc3ccc(O)cc3)N2C(=O)CN1C)c1ccccc1 |
| InChI | InChI=1S/C35H36N4O4/c1-24(26-9-4-3-5-10-26)19-33(41)39-32-22-37(21-28-13-8-12-27-11-6-7-14-30(27)28)35(43)31(38(32)34(42)23-36(39)2)20-25-15-17-29(40)18-16-25/h3-18,24,31-32,40H,19-23H2,1-2H3/t24-,31-,32?/m0/s1 |
| InChIKey | KTDKCYGZZZVYIP-VKWAJXIKSA-N |
| XLogP | 4.54 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |