C31H63NO2 — CID 159236036
2,5-dimethylhexan-3-one;bis((E)-2,5-dimethylhex-3-ene);2-methyl-N-propan-2-ylpropanamide (PubChem CID 159236036) has the molecular formula C31H63NO2 and a molecular weight of 481.85 g/mol. Its IUPAC name is 2,5-dimethylhexan-3-one;bis((E)-2,5-dimethylhex-3-ene);2-methyl-N-propan-2-ylpropanamide.
| Compound Name | 2,5-dimethylhexan-3-one;bis((E)-2,5-dimethylhex-3-ene);2-methyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 159236036 |
| Molecular Formula | C31H63NO2 |
| Molecular Weight | 481.85 g/mol |
| Exact Mass | 481.49 |
| IUPAC Name | 2,5-dimethylhexan-3-one;bis((E)-2,5-dimethylhex-3-ene);2-methyl-N-propan-2-ylpropanamide |
| SMILES | CC(C)/C=C/C(C)C.CC(C)/C=C/C(C)C.CC(C)CC(=O)C(C)C.CC(C)NC(=O)C(C)C |
| InChI | InChI=1S/C8H16O.2C8H16.C7H15NO/c1-6(2)5-8(9)7(3)4;2*1-7(2)5-6-8(3)4;1-5(2)7(9)8-6(3)4/h6-7H,5H2,1-4H3;2*5-8H,1-4H3;5-6H,1-4H3,(H,8,9)/b;2*6-5+; |
| InChIKey | KTMDKQPUGYURQX-DUKIEZBSSA-N |
| XLogP | 9.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.85 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|