C16H30N2O3S — CID 167448082
2-(4-methyl-3-oxopentyl)sulfanyl-N,N'-di(propan-2-yl)butanediamide (PubChem CID 167448082) has the molecular formula C16H30N2O3S and a molecular weight of 330.49 g/mol. Its IUPAC name is 2-(4-methyl-3-oxopentyl)sulfanyl-N,N'-di(propan-2-yl)butanediamide.
| Compound Name | 2-(4-methyl-3-oxopentyl)sulfanyl-N,N'-di(propan-2-yl)butanediamide |
|---|---|
| PubChem CID | 167448082 |
| Molecular Formula | C16H30N2O3S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-(4-methyl-3-oxopentyl)sulfanyl-N,N'-di(propan-2-yl)butanediamide |
| SMILES | CC(C)NC(=O)CC(SCCC(=O)C(C)C)C(=O)NC(C)C |
| InChI | InChI=1S/C16H30N2O3S/c1-10(2)13(19)7-8-22-14(16(21)18-12(5)6)9-15(20)17-11(3)4/h10-12,14H,7-9H2,1-6H3,(H,17,20)(H,18,21) |
| InChIKey | WZMQWXQCUCGAST-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |