C16H33N3O3S — CID 167447987
2-(2-amino-3-oxobutyl)sulfanyl-N,N'-di(propan-2-yl)butanediamide;ethane (PubChem CID 167447987) has the molecular formula C16H33N3O3S and a molecular weight of 347.53 g/mol. Its IUPAC name is 2-(2-amino-3-oxobutyl)sulfanyl-N,N'-di(propan-2-yl)butanediamide;ethane.
| Compound Name | 2-(2-amino-3-oxobutyl)sulfanyl-N,N'-di(propan-2-yl)butanediamide;ethane |
|---|---|
| PubChem CID | 167447987 |
| Molecular Formula | C16H33N3O3S |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-(2-amino-3-oxobutyl)sulfanyl-N,N'-di(propan-2-yl)butanediamide;ethane |
| SMILES | CC.CC(=O)C(N)CSC(CC(=O)NC(C)C)C(=O)NC(C)C |
| InChI | InChI=1S/C14H27N3O3S.C2H6/c1-8(2)16-13(19)6-12(14(20)17-9(3)4)21-7-11(15)10(5)18;1-2/h8-9,11-12H,6-7,15H2,1-5H3,(H,16,19)(H,17,20);1-2H3 |
| InChIKey | WMQZJVAOJREAEA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |