C15H28N2O3S — CID 178008010
N'-ethyl-2-(4-methyl-3-oxopentyl)sulfanyl-N-propan-2-ylbutanediamide (PubChem CID 178008010) has the molecular formula C15H28N2O3S and a molecular weight of 316.47 g/mol. Its IUPAC name is N'-ethyl-2-(4-methyl-3-oxopentyl)sulfanyl-N-propan-2-ylbutanediamide.
| Compound Name | N'-ethyl-2-(4-methyl-3-oxopentyl)sulfanyl-N-propan-2-ylbutanediamide |
|---|---|
| PubChem CID | 178008010 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N'-ethyl-2-(4-methyl-3-oxopentyl)sulfanyl-N-propan-2-ylbutanediamide |
| SMILES | CCNC(=O)CC(SCCC(=O)C(C)C)C(=O)NC(C)C |
| InChI | InChI=1S/C15H28N2O3S/c1-6-16-14(19)9-13(15(20)17-11(4)5)21-8-7-12(18)10(2)3/h10-11,13H,6-9H2,1-5H3,(H,16,19)(H,17,20) |
| InChIKey | PJHMICVZOBUSSH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |