C29H49N5O9S — CID 176953189
N,N'-bis[2-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)oxyethyl]-2-(4-methyl-3-oxopentyl)sulfanylbutanediamide;methanamine (PubChem CID 176953189) has the molecular formula C29H49N5O9S and a molecular weight of 643.80 g/mol. Its IUPAC name is N,N'-bis[2-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)oxyethyl]-2-(4-methyl-3-oxopentyl)sulfanylbutanediamide;methanamine.
| Compound Name | N,N'-bis[2-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)oxyethyl]-2-(4-methyl-3-oxopentyl)sulfanylbutanediamide;methanamine |
|---|---|
| PubChem CID | 176953189 |
| Molecular Formula | C29H49N5O9S |
| Molecular Weight | 643.80 g/mol |
| Exact Mass | 643.33 |
| IUPAC Name | N,N'-bis[2-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)oxyethyl]-2-(4-methyl-3-oxopentyl)sulfanylbutanediamide;methanamine |
| SMILES | CC(C)C(=O)CCSC(CC(=O)NCCOC1CC(=O)N(C(C)C)C1=O)C(=O)NCCOC1CC(=O)N(C(C)C)C1=O.CN |
| InChI | InChI=1S/C28H44N4O9S.CH5N/c1-16(2)19(33)7-12-42-22(26(37)30-9-11-41-21-14-25(36)32(18(5)6)28(21)39)15-23(34)29-8-10-40-20-13-24(35)31(17(3)4)27(20)38;1-2/h16-18,20-22H,7-15H2,1-6H3,(H,29,34)(H,30,37);2H2,1H3 |
| InChIKey | ABONKLZNWAVKFE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 194.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.80 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|