C14H25N3O3S — CID 166975348
2-[(2R)-2-amino-4-methyl-3-oxopentyl]sulfanyl-N-ethenyl-N'-ethylbutanediamide (PubChem CID 166975348) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is 2-[(2R)-2-amino-4-methyl-3-oxopentyl]sulfanyl-N-ethenyl-N'-ethylbutanediamide.
| Compound Name | 2-[(2R)-2-amino-4-methyl-3-oxopentyl]sulfanyl-N-ethenyl-N'-ethylbutanediamide |
|---|---|
| PubChem CID | 166975348 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-[(2R)-2-amino-4-methyl-3-oxopentyl]sulfanyl-N-ethenyl-N'-ethylbutanediamide |
| SMILES | C=CNC(=O)C(CC(=O)NCC)SC[C@H](N)C(=O)C(C)C |
| InChI | InChI=1S/C14H25N3O3S/c1-5-16-12(18)7-11(14(20)17-6-2)21-8-10(15)13(19)9(3)4/h6,9-11H,2,5,7-8,15H2,1,3-4H3,(H,16,18)(H,17,20)/t10-,11?/m0/s1 |
| InChIKey | PLGJFEUGBIRDQQ-VUWPPUDQSA-N |
| XLogP | 0.43 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |