C18H36N5O3S — CID 59411874
CID 59411874 (PubChem CID 59411874) has the molecular formula C18H36N5O3S and a molecular weight of 402.59 g/mol.
| Compound Name | CID 59411874 |
|---|---|
| PubChem CID | 59411874 |
| Molecular Formula | C18H36N5O3S |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | — |
| SMILES | CC(C)NC(=O)[CH]CSC(CC(=O)NCCN(C)C)C(=O)NCCN(C)C |
| InChI | InChI=1S/C18H36N5O3S/c1-14(2)21-16(24)7-12-27-15(18(26)20-9-11-23(5)6)13-17(25)19-8-10-22(3)4/h7,14-15H,8-13H2,1-6H3,(H,19,25)(H,20,26)(H,21,24) |
| InChIKey | LBNYXYRPHSUGMN-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |