C19H30N3O2S — CID 59411891
CID 59411891 (PubChem CID 59411891) has the molecular formula C19H30N3O2S and a molecular weight of 364.54 g/mol.
| Compound Name | CID 59411891 |
|---|---|
| PubChem CID | 59411891 |
| Molecular Formula | C19H30N3O2S |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | — |
| SMILES | CCN(CCCNC(=O)CSC[CH]C(=O)NC(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H30N3O2S/c1-4-22(17-9-6-5-7-10-17)13-8-12-20-19(24)15-25-14-11-18(23)21-16(2)3/h5-7,9-11,16H,4,8,12-15H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | DWYBYMRIQNPGLV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|