C14H28N3O2S — CID 59411884
CID 59411884 (PubChem CID 59411884) has the molecular formula C14H28N3O2S and a molecular weight of 302.46 g/mol.
| Compound Name | CID 59411884 |
|---|---|
| PubChem CID | 59411884 |
| Molecular Formula | C14H28N3O2S |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | — |
| SMILES | CC(C)NC(=O)[CH]CSCCC(=O)NCCCN(C)C |
| InChI | InChI=1S/C14H28N3O2S/c1-12(2)16-14(19)7-11-20-10-6-13(18)15-8-5-9-17(3)4/h7,12H,5-6,8-11H2,1-4H3,(H,15,18)(H,16,19) |
| InChIKey | VDCPYZSDTWHWQW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|