C13H23NO3 — CID 157173964
8-methyl-4,7-dioxo-N-propan-2-ylnonanamide (PubChem CID 157173964) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 8-methyl-4,7-dioxo-N-propan-2-ylnonanamide.
| Compound Name | 8-methyl-4,7-dioxo-N-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 157173964 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 8-methyl-4,7-dioxo-N-propan-2-ylnonanamide |
| SMILES | CC(C)NC(=O)CCC(=O)CCC(=O)C(C)C |
| InChI | InChI=1S/C13H23NO3/c1-9(2)12(16)7-5-11(15)6-8-13(17)14-10(3)4/h9-10H,5-8H2,1-4H3,(H,14,17) |
| InChIKey | GVGPPPUBKOWIFY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |