C26H41NO7 — CID 167695347
N-[(3S,8R)-8-acetyl-2,6,11-trioxododecan-3-yl]-10-methyl-4,9-dioxoundecanamide (PubChem CID 167695347) has the molecular formula C26H41NO7 and a molecular weight of 479.61 g/mol. Its IUPAC name is N-[(3S,8R)-8-acetyl-2,6,11-trioxododecan-3-yl]-10-methyl-4,9-dioxoundecanamide.
| Compound Name | N-[(3S,8R)-8-acetyl-2,6,11-trioxododecan-3-yl]-10-methyl-4,9-dioxoundecanamide |
|---|---|
| PubChem CID | 167695347 |
| Molecular Formula | C26H41NO7 |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | N-[(3S,8R)-8-acetyl-2,6,11-trioxododecan-3-yl]-10-methyl-4,9-dioxoundecanamide |
| SMILES | CC(=O)CC[C@H](CC(=O)CC[C@H](NC(=O)CCC(=O)CCCCC(=O)C(C)C)C(C)=O)C(C)=O |
| InChI | InChI=1S/C26H41NO7/c1-17(2)25(33)9-7-6-8-22(31)13-15-26(34)27-24(20(5)30)14-12-23(32)16-21(19(4)29)11-10-18(3)28/h17,21,24H,6-16H2,1-5H3,(H,27,34)/t21-,24+/m1/s1 |
| InChIKey | BUGPBQTXNBLGSF-QPPBQGQZSA-N |
| XLogP | 3.51 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|