C31H62N4O10 — CID 159236783
2-[[2-(methoxymethyl)-3-[5-(methylamino)pentylcarbamoyloxy]propoxy]methoxy]prop-2-enyl acetate;5-methoxypentyl N-[5-(methylamino)pentyl]carbamate (PubChem CID 159236783) has the molecular formula C31H62N4O10 and a molecular weight of 650.86 g/mol. Its IUPAC name is 2-[[2-(methoxymethyl)-3-[5-(methylamino)pentylcarbamoyloxy]propoxy]methoxy]prop-2-enyl acetate;5-methoxypentyl N-[5-(methylamino)pentyl]carbamate.
| Compound Name | 2-[[2-(methoxymethyl)-3-[5-(methylamino)pentylcarbamoyloxy]propoxy]methoxy]prop-2-enyl acetate;5-methoxypentyl N-[5-(methylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 159236783 |
| Molecular Formula | C31H62N4O10 |
| Molecular Weight | 650.86 g/mol |
| Exact Mass | 650.45 |
| IUPAC Name | 2-[[2-(methoxymethyl)-3-[5-(methylamino)pentylcarbamoyloxy]propoxy]methoxy]prop-2-enyl acetate;5-methoxypentyl N-[5-(methylamino)pentyl]carbamate |
| SMILES | C=C(COC(C)=O)OCOCC(COC)COC(=O)NCCCCCNC.CNCCCCCNC(=O)OCCCCCOC |
| InChI | InChI=1S/C18H34N2O7.C13H28N2O3/c1-15(10-25-16(2)21)27-14-24-12-17(11-23-4)13-26-18(22)20-9-7-5-6-8-19-3;1-14-9-5-3-6-10-15-13(16)18-12-8-4-7-11-17-2/h17,19H,1,5-14H2,2-4H3,(H,20,22);14H,3-12H2,1-2H3,(H,15,16) |
| InChIKey | KTOPYVJCBHRGHB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|