C33H53NO3 — CID 159240287
3-[(1R,2R,5R,8R,9R,10R,13R,14R)-5-ethyl-1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-17-yl]-3-oxopropanoic acid (PubChem CID 159240287) has the molecular formula C33H53NO3 and a molecular weight of 511.79 g/mol. Its IUPAC name is 3-[(1R,2R,5R,8R,9R,10R,13R,14R)-5-ethyl-1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-17-yl]-3-oxopropanoic acid.
| Compound Name | 3-[(1R,2R,5R,8R,9R,10R,13R,14R)-5-ethyl-1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-17-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 159240287 |
| Molecular Formula | C33H53NO3 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 511.40 |
| IUPAC Name | 3-[(1R,2R,5R,8R,9R,10R,13R,14R)-5-ethyl-1,2,14,18,18-pentamethyl-8-prop-1-en-2-yl-17-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosan-17-yl]-3-oxopropanoic acid |
| SMILES | C=C(C)[C@@H]1CC[C@]2(CC)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CCN(C(=O)CC(=O)O)C(C)(C)C5CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C33H53NO3/c1-9-33-15-12-22(21(2)3)28(33)23-10-11-25-30(6)18-19-34(26(35)20-27(36)37)29(4,5)24(30)13-14-32(25,8)31(23,7)16-17-33/h22-25,28H,2,9-20H2,1,3-8H3,(H,36,37)/t22-,23+,24?,25+,28+,30-,31+,32+,33+/m0/s1 |
| InChIKey | JCLCATOIUNVJSV-IIEDDZPJSA-N |
| XLogP | 7.72 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|