C51H47BN4OP — CID 159240823
CID 159240823 (PubChem CID 159240823) has the molecular formula C51H47BN4OP and a molecular weight of 773.75 g/mol.
| Compound Name | CID 159240823 |
|---|---|
| PubChem CID | 159240823 |
| Molecular Formula | C51H47BN4OP |
| Molecular Weight | 773.75 g/mol |
| Exact Mass | 773.36 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(-c2nnc(-c3ccc(-c4ccccc4)cc3)o2)cc1.C[B]P.Cc1cc(-c2ccccc2)c2ccc3c(-c4ccccc4)cc(C)nc3c2n1 |
| InChI | InChI=1S/C26H20N2.C24H22N2O.CH5BP/c1-17-15-23(19-9-5-3-6-10-19)21-13-14-22-24(20-11-7-4-8-12-20)16-18(2)28-26(22)25(21)27-17;1-24(2,3)21-15-13-20(14-16-21)23-26-25-22(27-23)19-11-9-18(10-12-19)17-7-5-4-6-8-17;1-2-3/h3-16H,1-2H3;4-16H,1-3H3;3H2,1H3 |
| InChIKey | DZNNREYWCBBBCW-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.75 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|