C12H34O4Si4 — CID 159258126
2-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propan-2-ol (PubChem CID 159258126) has the molecular formula C12H34O4Si4 and a molecular weight of 354.74 g/mol. Its IUPAC name is 2-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propan-2-ol.
| Compound Name | 2-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propan-2-ol |
|---|---|
| PubChem CID | 159258126 |
| Molecular Formula | C12H34O4Si4 |
| Molecular Weight | 354.74 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propan-2-ol |
| SMILES | CC(C)(O)[Si](C)(O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H34O4Si4/c1-12(2,13)20(11,15-18(6,7)8)16-19(9,10)14-17(3,4)5/h13H,1-11H3 |
| InChIKey | LGNVHZYWTSWKHG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.74 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|