C28H35FN2O4 — CID 159258325
(2R)-2-(2-cyclopropyloxyphenyl)-2-[(3R,4S)-3-fluoro-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 159258325) has the molecular formula C28H35FN2O4 and a molecular weight of 482.60 g/mol. Its IUPAC name is (2R)-2-(2-cyclopropyloxyphenyl)-2-[(3R,4S)-3-fluoro-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2R)-2-(2-cyclopropyloxyphenyl)-2-[(3R,4S)-3-fluoro-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 159258325 |
| Molecular Formula | C28H35FN2O4 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | (2R)-2-(2-cyclopropyloxyphenyl)-2-[(3R,4S)-3-fluoro-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@@H](c1ccccc1OC1CC1)N1C[C@@H](F)[C@@H](OCCCCc2ccc3c(n2)CCCC3)C1 |
| InChI | InChI=1S/C28H35FN2O4/c29-23-17-31(27(28(32)33)22-9-2-4-11-25(22)35-21-14-15-21)18-26(23)34-16-6-5-8-20-13-12-19-7-1-3-10-24(19)30-20/h2,4,9,11-13,21,23,26-27H,1,3,5-8,10,14-18H2,(H,32,33)/t23-,26+,27-/m1/s1 |
| InChIKey | IZKQQWGLXKEZON-DURWQBQJSA-N |
| XLogP | 4.69 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|