C29H48N2O8 — CID 159264008
2-cyclohexyl-1-methoxycarbonylpiperidine-4-carboxylic acid;dimethyl 2-cyclohexylpiperidine-1,4-dicarboxylate (PubChem CID 159264008) has the molecular formula C29H48N2O8 and a molecular weight of 552.71 g/mol. Its IUPAC name is 2-cyclohexyl-1-methoxycarbonylpiperidine-4-carboxylic acid;dimethyl 2-cyclohexylpiperidine-1,4-dicarboxylate.
| Compound Name | 2-cyclohexyl-1-methoxycarbonylpiperidine-4-carboxylic acid;dimethyl 2-cyclohexylpiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 159264008 |
| Molecular Formula | C29H48N2O8 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | 2-cyclohexyl-1-methoxycarbonylpiperidine-4-carboxylic acid;dimethyl 2-cyclohexylpiperidine-1,4-dicarboxylate |
| SMILES | COC(=O)C1CCN(C(=O)OC)C(C2CCCCC2)C1.COC(=O)N1CCC(C(=O)O)CC1C1CCCCC1 |
| InChI | InChI=1S/C15H25NO4.C14H23NO4/c1-19-14(17)12-8-9-16(15(18)20-2)13(10-12)11-6-4-3-5-7-11;1-19-14(18)15-8-7-11(13(16)17)9-12(15)10-5-3-2-4-6-10/h11-13H,3-10H2,1-2H3;10-12H,2-9H2,1H3,(H,16,17) |
| InChIKey | KWWFCFGIFKZEIR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|