C28H31N3O5 — CID 159264983
1-[(3R)-3-[4-[2-(3-methylphenyl)-2-oxoethyl]-10,13,16-trioxa-3,5-diazatricyclo[7.7.0.02,6]hexadeca-1(9),2(6),4,7-tetraen-3-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 159264983) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is 1-[(3R)-3-[4-[2-(3-methylphenyl)-2-oxoethyl]-10,13,16-trioxa-3,5-diazatricyclo[7.7.0.02,6]hexadeca-1(9),2(6),4,7-tetraen-3-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-[2-(3-methylphenyl)-2-oxoethyl]-10,13,16-trioxa-3,5-diazatricyclo[7.7.0.02,6]hexadeca-1(9),2(6),4,7-tetraen-3-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 159264983 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 1-[(3R)-3-[4-[2-(3-methylphenyl)-2-oxoethyl]-10,13,16-trioxa-3,5-diazatricyclo[7.7.0.02,6]hexadeca-1(9),2(6),4,7-tetraen-3-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2c(CC(=O)c3cccc(C)c3)nc3ccc4c(c32)OCCOCCO4)C1 |
| InChI | InChI=1S/C28H31N3O5/c1-3-26(33)30-11-5-8-21(18-30)31-25(17-23(32)20-7-4-6-19(2)16-20)29-22-9-10-24-28(27(22)31)36-15-13-34-12-14-35-24/h3-4,6-7,9-10,16,21H,1,5,8,11-15,17-18H2,2H3/t21-/m1/s1 |
| InChIKey | WCWAOXAAUIFENL-OAQYLSRUSA-N |
| XLogP | 3.91 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|