C21H18F3N3O2S — CID 159265968
1-[(5S,7R)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-4-thiophen-2-ylbutane-1,4-dione (PubChem CID 159265968) has the molecular formula C21H18F3N3O2S and a molecular weight of 433.46 g/mol. Its IUPAC name is 1-[(5S,7R)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-4-thiophen-2-ylbutane-1,4-dione.
| Compound Name | 1-[(5S,7R)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-4-thiophen-2-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 159265968 |
| Molecular Formula | C21H18F3N3O2S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 1-[(5S,7R)-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-4-thiophen-2-ylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)c1cnn2c1N[C@H](c1ccccc1)C[C@@H]2C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C21H18F3N3O2S/c22-21(23,24)19-11-15(13-5-2-1-3-6-13)26-20-14(12-25-27(19)20)16(28)8-9-17(29)18-7-4-10-30-18/h1-7,10,12,15,19,26H,8-9,11H2/t15-,19+/m0/s1 |
| InChIKey | KXCJAVHFGKDXGV-HNAYVOBHSA-N |
| XLogP | 5.45 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |