C25H28F3N3O2 — CID 161366694
2-(1-adamantyl)-1-[(5S,7R)-5-(2-hydroxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethanone (PubChem CID 161366694) has the molecular formula C25H28F3N3O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-[(5S,7R)-5-(2-hydroxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethanone.
| Compound Name | 2-(1-adamantyl)-1-[(5S,7R)-5-(2-hydroxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethanone |
|---|---|
| PubChem CID | 161366694 |
| Molecular Formula | C25H28F3N3O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 2-(1-adamantyl)-1-[(5S,7R)-5-(2-hydroxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]ethanone |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)c1cnn2c1N[C@H](c1ccccc1O)C[C@@H]2C(F)(F)F |
| InChI | InChI=1S/C25H28F3N3O2/c26-25(27,28)22-8-19(17-3-1-2-4-20(17)32)30-23-18(13-29-31(22)23)21(33)12-24-9-14-5-15(10-24)7-16(6-14)11-24/h1-4,13-16,19,22,30,32H,5-12H2/t14?,15?,16?,19-,22+,24?/m0/s1 |
| InChIKey | VPXHBEWMLYYDPL-XOAVURIRSA-N |
| XLogP | 6.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|