C27H39Br2IN4O2Si2 — CID 159266510
2-[(5-bromo-4-iodopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane;2-[(5-bromo-4-methylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 159266510) has the molecular formula C27H39Br2IN4O2Si2 and a molecular weight of 794.52 g/mol. Its IUPAC name is 2-[(5-bromo-4-iodopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane;2-[(5-bromo-4-methylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5-bromo-4-iodopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane;2-[(5-bromo-4-methylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 159266510 |
| Molecular Formula | C27H39Br2IN4O2Si2 |
| Molecular Weight | 794.52 g/mol |
| Exact Mass | 792.00 |
| IUPAC Name | 2-[(5-bromo-4-iodopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane;2-[(5-bromo-4-methylpyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(I)c(Br)cnc21.Cc1c(Br)cnc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C14H21BrN2OSi.C13H18BrIN2OSi/c1-11-12-5-6-17(14(12)16-9-13(11)15)10-18-7-8-19(2,3)4;1-19(2,3)7-6-18-9-17-5-4-10-12(15)11(14)8-16-13(10)17/h5-6,9H,7-8,10H2,1-4H3;4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | KXEBCSRVCBYXBB-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.52 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|