C35H32BN3O2 — CID 159271231
6,16-ditert-butyl-4,18-diphenyl-8,14-dioxa-3,10,19-triaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 159271231) has the molecular formula C35H32BN3O2 and a molecular weight of 537.47 g/mol. Its IUPAC name is 6,16-ditert-butyl-4,18-diphenyl-8,14-dioxa-3,10,19-triaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 6,16-ditert-butyl-4,18-diphenyl-8,14-dioxa-3,10,19-triaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 159271231 |
| Molecular Formula | C35H32BN3O2 |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 6,16-ditert-butyl-4,18-diphenyl-8,14-dioxa-3,10,19-triaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)nc2c1Oc1ccnc3c1B2c1nc(-c2ccccc2)cc(C(C)(C)C)c1O3 |
| InChI | InChI=1S/C35H32BN3O2/c1-34(2,3)23-19-25(21-13-9-7-10-14-21)38-31-29(23)40-27-17-18-37-33-28(27)36(31)32-30(41-33)24(35(4,5)6)20-26(39-32)22-15-11-8-12-16-22/h7-20H,1-6H3 |
| InChIKey | OCIPVOABNTZWQZ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|