C15H23NO2P2 — CID 159271930
2-bicyclo[2.2.1]hept-5-enylmethyl(methyl)phosphane;1-(methylphosphanylmethyl)pyrrole-2,5-dione (PubChem CID 159271930) has the molecular formula C15H23NO2P2 and a molecular weight of 311.30 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethyl(methyl)phosphane;1-(methylphosphanylmethyl)pyrrole-2,5-dione.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethyl(methyl)phosphane;1-(methylphosphanylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 159271930 |
| Molecular Formula | C15H23NO2P2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethyl(methyl)phosphane;1-(methylphosphanylmethyl)pyrrole-2,5-dione |
| SMILES | CPCC1CC2C=CC1C2.CPCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H15P.C6H8NO2P/c1-10-6-9-5-7-2-3-8(9)4-7;1-10-4-7-5(8)2-3-6(7)9/h2-3,7-10H,4-6H2,1H3;2-3,10H,4H2,1H3 |
| InChIKey | KXUZISWWVRFOTO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|