C26H29N2+ — CID 159276865
7'-(4-ethyl-1-methylpyridin-1-ium-2-yl)-2',6'-dimethylspiro[cyclopentane-1,9'-indeno[2,1-b]pyridine] (PubChem CID 159276865) has the molecular formula C26H29N2+ and a molecular weight of 369.53 g/mol. Its IUPAC name is 7'-(4-ethyl-1-methylpyridin-1-ium-2-yl)-2',6'-dimethylspiro[cyclopentane-1,9'-indeno[2,1-b]pyridine].
| Compound Name | 7'-(4-ethyl-1-methylpyridin-1-ium-2-yl)-2',6'-dimethylspiro[cyclopentane-1,9'-indeno[2,1-b]pyridine] |
|---|---|
| PubChem CID | 159276865 |
| Molecular Formula | C26H29N2+ |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 7'-(4-ethyl-1-methylpyridin-1-ium-2-yl)-2',6'-dimethylspiro[cyclopentane-1,9'-indeno[2,1-b]pyridine] |
| SMILES | CCc1cc[n+](C)c(-c2cc3c(cc2C)-c2ccc(C)nc2C32CCCC2)c1 |
| InChI | InChI=1S/C26H29N2/c1-5-19-10-13-28(4)24(15-19)21-16-23-22(14-17(21)2)20-9-8-18(3)27-25(20)26(23)11-6-7-12-26/h8-10,13-16H,5-7,11-12H2,1-4H3/q+1 |
| InChIKey | UZYYAIYUGOOMOL-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|